C25H29N3O4 — CID 46830330
(5S)-N-benzyl-1-cyclopentyl-3,6-dioxo-5-(phenylmethoxymethyl)piperazine-2-carboxamide (PubChem CID 46830330) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is (5S)-N-benzyl-1-cyclopentyl-3,6-dioxo-5-(phenylmethoxymethyl)piperazine-2-carboxamide.
| Compound Name | (5S)-N-benzyl-1-cyclopentyl-3,6-dioxo-5-(phenylmethoxymethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 46830330 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (5S)-N-benzyl-1-cyclopentyl-3,6-dioxo-5-(phenylmethoxymethyl)piperazine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1C(=O)N[C@@H](COCc2ccccc2)C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C25H29N3O4/c29-23(26-15-18-9-3-1-4-10-18)22-24(30)27-21(17-32-16-19-11-5-2-6-12-19)25(31)28(22)20-13-7-8-14-20/h1-6,9-12,20-22H,7-8,13-17H2,(H,26,29)(H,27,30)/t21-,22?/m0/s1 |
| InChIKey | QFNUBHQRQFPMMH-HMTLIYDFSA-N |
| XLogP | 2.16 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|