C9H10Cl2N2O2 — CID 124560204
[(1R)-2-amino-1-(2,3-dichlorophenyl)ethyl] carbamate (PubChem CID 124560204) has the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.10 g/mol. Its IUPAC name is [(1R)-2-amino-1-(2,3-dichlorophenyl)ethyl] carbamate.
| Compound Name | [(1R)-2-amino-1-(2,3-dichlorophenyl)ethyl] carbamate |
|---|---|
| PubChem CID | 124560204 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | [(1R)-2-amino-1-(2,3-dichlorophenyl)ethyl] carbamate |
| SMILES | NC[C@H](OC(N)=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl2N2O2/c10-6-3-1-2-5(8(6)11)7(4-12)15-9(13)14/h1-3,7H,4,12H2,(H2,13,14)/t7-/m0/s1 |
| InChIKey | MBJQWYMUCUTIND-ZETCQYMHSA-N |
| XLogP | 2.09 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |