About tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate
tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate (PubChem CID 124562037) has the molecular formula C17H25ClN2O4
and a molecular weight of 356.85 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate.
Molecular Properties
| Compound Name | tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate |
| PubChem CID | 124562037 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](O)c1c(Cl)ccnc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H25ClN2O4/c1-16(2,3)15(23)20-14-13(10(18)7-8-19-14)11(21)9-12(22)24-17(4,5)6/h7-8,11,21H,9H2,1-6H3,(H,19,20,23)/t11-/m1/s1 |
| InChIKey | SJTJUWNIASJADU-LLVKDONJSA-N |
| XLogP | 3.48 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate?
The IUPAC name of tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate (CID 124562037) is tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate.
What is the SMILES notation for tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate?
The canonical SMILES for tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate is CC(C)(C)OC(=O)C[C@@H](O)c1c(Cl)ccnc1NC(=O)C(C)(C)C.
What is the InChIKey of tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate?
The InChIKey is SJTJUWNIASJADU-LLVKDONJSA-N. The full InChI is InChI=1S/C17H25ClN2O4/c1-16(2,3)15(23)20-14-13(10(18)7-8-19-14)11(21)9-12(22)24-17(4,5)6/h7-8,11,21H,9H2,1-6H3,(H,19,20,23)/t11-/m1/s1.
What are the key properties of tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate?
tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate has a molecular weight of 356.85 g/mol, XLogP of 3.48, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R)-3-[4-chloro-2-(2,2-dimethylpropanoylamino)-3-pyridinyl]-3-hydroxypropanoate is sourced from PubChem (CID 124562037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).