C14H15NO2S — CID 124564889
(2R)-2-(3-cyanophenyl)-2-cyclopentylsulfanylacetic acid (PubChem CID 124564889) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is (2R)-2-(3-cyanophenyl)-2-cyclopentylsulfanylacetic acid.
| Compound Name | (2R)-2-(3-cyanophenyl)-2-cyclopentylsulfanylacetic acid |
|---|---|
| PubChem CID | 124564889 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (2R)-2-(3-cyanophenyl)-2-cyclopentylsulfanylacetic acid |
| SMILES | N#Cc1cccc([C@@H](SC2CCCC2)C(=O)O)c1 |
| InChI | InChI=1S/C14H15NO2S/c15-9-10-4-3-5-11(8-10)13(14(16)17)18-12-6-1-2-7-12/h3-5,8,12-13H,1-2,6-7H2,(H,16,17)/t13-/m1/s1 |
| InChIKey | GLWVOZQVTMMBQQ-CYBMUJFWSA-N |
| XLogP | 3.36 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |