C5H10N4O — CID 124571201
3-[(1R)-1-aminoethyl]-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 124571201) has the molecular formula C5H10N4O and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-[(1R)-1-aminoethyl]-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(1R)-1-aminoethyl]-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 124571201 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 3-[(1R)-1-aminoethyl]-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | C[C@@H](N)c1n[nH]c(=O)n1C |
| InChI | InChI=1S/C5H10N4O/c1-3(6)4-7-8-5(10)9(4)2/h3H,6H2,1-2H3,(H,8,10)/t3-/m1/s1 |
| InChIKey | DTRBUPYMJCJJPE-GSVOUGTGSA-N |
| XLogP | -0.87 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |