C20H25N3O — CID 124572413
5-[[[(1R,1aS,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]methylamino]methyl]-N,N-dimethyl-1H-pyrrole-2-carboxamide (PubChem CID 124572413) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 5-[[[(1R,1aS,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]methylamino]methyl]-N,N-dimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | 5-[[[(1R,1aS,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]methylamino]methyl]-N,N-dimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 124572413 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 5-[[[(1R,1aS,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]methylamino]methyl]-N,N-dimethyl-1H-pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(CNC[C@@H]2[C@H]3CCc4ccccc4[C@@H]32)[nH]1 |
| InChI | InChI=1S/C20H25N3O/c1-23(2)20(24)18-10-8-14(22-18)11-21-12-17-16-9-7-13-5-3-4-6-15(13)19(16)17/h3-6,8,10,16-17,19,21-22H,7,9,11-12H2,1-2H3/t16-,17-,19+/m1/s1 |
| InChIKey | CTTGTXJGAKWCCZ-LMMKCTJWSA-N |
| XLogP | 2.78 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |