C18H17N3O — CID 99696102
N-[[(1R,1aR,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]methyl]-5-cyano-1H-pyrrole-2-carboxamide (PubChem CID 99696102) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[[(1R,1aR,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]methyl]-5-cyano-1H-pyrrole-2-carboxamide.
| Compound Name | N-[[(1R,1aR,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]methyl]-5-cyano-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 99696102 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[[(1R,1aR,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]methyl]-5-cyano-1H-pyrrole-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)NC[C@@H]2[C@@H]3CCc4ccccc4[C@H]23)[nH]1 |
| InChI | InChI=1S/C18H17N3O/c19-9-12-6-8-16(21-12)18(22)20-10-15-14-7-5-11-3-1-2-4-13(11)17(14)15/h1-4,6,8,14-15,17,21H,5,7,10H2,(H,20,22)/t14-,15+,17-/m0/s1 |
| InChIKey | RGDLECFYKSJBIO-UXLLHSPISA-N |
| XLogP | 2.59 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |