C13H13NO2 — CID 173357545
2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid (PubChem CID 173357545) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid.
| Compound Name | 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid |
|---|---|
| PubChem CID | 173357545 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid |
| SMILES | N#CC1c2ccccc2CCC1CC(=O)O |
| InChI | InChI=1S/C13H13NO2/c14-8-12-10(7-13(15)16)6-5-9-3-1-2-4-11(9)12/h1-4,10,12H,5-7H2,(H,15,16) |
| InChIKey | ZWSXKZRJUDEJPR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |