2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid

C13H13NO2 — CID 173357545

IUPAC2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid
SMILESN#CC1c2ccccc2CCC1CC(=O)O
InChIInChI=1S/C13H13NO2/c14-8-12-10(7-13(15)16)6-5-9-3-1-2-4-11(9)12/h1-4,10,12H,5-7H2,(H,15,16)
InChIKeyZWSXKZRJUDEJPR-UHFFFAOYSA-N
MW215.25 g/mol
LogP2.33
Rot. Bonds2

About 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid

2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid (PubChem CID 173357545) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid.

Molecular Properties

Compound Name2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid
PubChem CID173357545
Molecular FormulaC13H13NO2
Molecular Weight215.25 g/mol
Exact Mass215.09
IUPAC Name2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid
SMILESN#CC1c2ccccc2CCC1CC(=O)O
InChIInChI=1S/C13H13NO2/c14-8-12-10(7-13(15)16)6-5-9-3-1-2-4-11(9)12/h1-4,10,12H,5-7H2,(H,15,16)
InChIKeyZWSXKZRJUDEJPR-UHFFFAOYSA-N
XLogP2.33
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid?
The IUPAC name of 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid (CID 173357545) is 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid.
What is the SMILES notation for 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid?
The canonical SMILES for 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid is N#CC1c2ccccc2CCC1CC(=O)O.
What is the InChIKey of 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid?
The InChIKey is ZWSXKZRJUDEJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c14-8-12-10(7-13(15)16)6-5-9-3-1-2-4-11(9)12/h1-4,10,12H,5-7H2,(H,15,16).
What are the key properties of 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid?
2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid has a molecular weight of 215.25 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid is sourced from PubChem (CID 173357545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).