C17H19FN4O2 — CID 124574819
2-(4-fluorophenyl)-6-[(3S)-3-(methylamino)piperidine-1-carbonyl]pyridazin-3-one (PubChem CID 124574819) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-[(3S)-3-(methylamino)piperidine-1-carbonyl]pyridazin-3-one.
| Compound Name | 2-(4-fluorophenyl)-6-[(3S)-3-(methylamino)piperidine-1-carbonyl]pyridazin-3-one |
|---|---|
| PubChem CID | 124574819 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-(4-fluorophenyl)-6-[(3S)-3-(methylamino)piperidine-1-carbonyl]pyridazin-3-one |
| SMILES | CN[C@H]1CCCN(C(=O)c2ccc(=O)n(-c3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C17H19FN4O2/c1-19-13-3-2-10-21(11-13)17(24)15-8-9-16(23)22(20-15)14-6-4-12(18)5-7-14/h4-9,13,19H,2-3,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | DTNPKDVXYAIFCB-ZDUSSCGKSA-N |
| XLogP | 1.20 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |