C11H13NO3S — CID 124578461
(3S)-3-(3-methoxyphenyl)sulfonyl-2,3-dihydro-1H-pyrrole (PubChem CID 124578461) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is (3S)-3-(3-methoxyphenyl)sulfonyl-2,3-dihydro-1H-pyrrole.
| Compound Name | (3S)-3-(3-methoxyphenyl)sulfonyl-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 124578461 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (3S)-3-(3-methoxyphenyl)sulfonyl-2,3-dihydro-1H-pyrrole |
| SMILES | COc1cccc(S(=O)(=O)[C@H]2C=CNC2)c1 |
| InChI | InChI=1S/C11H13NO3S/c1-15-9-3-2-4-10(7-9)16(13,14)11-5-6-12-8-11/h2-7,11-12H,8H2,1H3/t11-/m0/s1 |
| InChIKey | WNRXYEXMOJJCEP-NSHDSACASA-N |
| XLogP | 0.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |