C17H17Cl2N3O4S — CID 124579497
[(2R)-4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 4-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate (PubChem CID 124579497) has the molecular formula C17H17Cl2N3O4S and a molecular weight of 430.31 g/mol. Its IUPAC name is [(2R)-4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 4-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate.
| Compound Name | [(2R)-4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 4-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 124579497 |
| Molecular Formula | C17H17Cl2N3O4S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | [(2R)-4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 4-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate |
| SMILES | Cc1nnc(NC(=O)CCC(=O)O[C@H](CCCl)C(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H17Cl2N3O4S/c1-10-21-22-17(27-10)20-14(23)6-7-15(24)26-13(8-9-18)16(25)11-2-4-12(19)5-3-11/h2-5,13H,6-9H2,1H3,(H,20,22,23)/t13-/m1/s1 |
| InChIKey | ZVZHDQDTQADVPT-CYBMUJFWSA-N |
| XLogP | 3.64 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|