C28H27Cl2NO5 — CID 5192141
[4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 4-[4-(2,5-dimethylphenoxy)anilino]-4-oxobutanoate (PubChem CID 5192141) has the molecular formula C28H27Cl2NO5 and a molecular weight of 528.43 g/mol. Its IUPAC name is [4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 4-[4-(2,5-dimethylphenoxy)anilino]-4-oxobutanoate.
| Compound Name | [4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 4-[4-(2,5-dimethylphenoxy)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 5192141 |
| Molecular Formula | C28H27Cl2NO5 |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [4-chloro-1-(4-chlorophenyl)-1-oxobutan-2-yl] 4-[4-(2,5-dimethylphenoxy)anilino]-4-oxobutanoate |
| SMILES | Cc1ccc(C)c(Oc2ccc(NC(=O)CCC(=O)OC(CCCl)C(=O)c3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C28H27Cl2NO5/c1-18-3-4-19(2)25(17-18)35-23-11-9-22(10-12-23)31-26(32)13-14-27(33)36-24(15-16-29)28(34)20-5-7-21(30)8-6-20/h3-12,17,24H,13-16H2,1-2H3,(H,31,32) |
| InChIKey | ONRMDSMUVJBTCS-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|