C26H22Cl2FNO5 — CID 4107317
[4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 4-[4-(2-chlorophenoxy)anilino]-4-oxobutanoate (PubChem CID 4107317) has the molecular formula C26H22Cl2FNO5 and a molecular weight of 518.37 g/mol. Its IUPAC name is [4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 4-[4-(2-chlorophenoxy)anilino]-4-oxobutanoate.
| Compound Name | [4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 4-[4-(2-chlorophenoxy)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4107317 |
| Molecular Formula | C26H22Cl2FNO5 |
| Molecular Weight | 518.37 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | [4-chloro-1-(4-fluorophenyl)-1-oxobutan-2-yl] 4-[4-(2-chlorophenoxy)anilino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OC(CCCl)C(=O)c1ccc(F)cc1)Nc1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C26H22Cl2FNO5/c27-16-15-23(26(33)17-5-7-18(29)8-6-17)35-25(32)14-13-24(31)30-19-9-11-20(12-10-19)34-22-4-2-1-3-21(22)28/h1-12,23H,13-16H2,(H,30,31) |
| InChIKey | PDFMUIYGSZCBMF-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.37 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|