C8H14N2O2S — CID 124585701
(S)-N-(3-cyanooxetan-3-yl)-2-methylpropane-2-sulfinamide (PubChem CID 124585701) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is (S)-N-(3-cyanooxetan-3-yl)-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-(3-cyanooxetan-3-yl)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 124585701 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (S)-N-(3-cyanooxetan-3-yl)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)NC1(C#N)COC1 |
| InChI | InChI=1S/C8H14N2O2S/c1-7(2,3)13(11)10-8(4-9)5-12-6-8/h10H,5-6H2,1-3H3/t13-/m0/s1 |
| InChIKey | IJHQPIWMCKRZMA-ZDUSSCGKSA-N |
| XLogP | 0.33 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |