C11H21NO4S — CID 129410526
methyl (2R)-2-[3-[[(R)-tert-butylsulfinyl]amino]oxetan-3-yl]propanoate (PubChem CID 129410526) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl (2R)-2-[3-[[(R)-tert-butylsulfinyl]amino]oxetan-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[3-[[(R)-tert-butylsulfinyl]amino]oxetan-3-yl]propanoate |
|---|---|
| PubChem CID | 129410526 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl (2R)-2-[3-[[(R)-tert-butylsulfinyl]amino]oxetan-3-yl]propanoate |
| SMILES | COC(=O)[C@H](C)C1(N[S@](=O)C(C)(C)C)COC1 |
| InChI | InChI=1S/C11H21NO4S/c1-8(9(13)15-5)11(6-16-7-11)12-17(14)10(2,3)4/h8,12H,6-7H2,1-5H3/t8-,17+/m0/s1 |
| InChIKey | QZBVVTBURWHEFT-WNWIJWBNSA-N |
| XLogP | 0.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |