C30H38N2O10 — CID 159072303
ethyl 2-[3-(phenylmethoxycarbonylamino)oxetan-3-yl]propanoate;2-[3-(phenylmethoxycarbonylamino)oxetan-3-yl]propanoic acid (PubChem CID 159072303) has the molecular formula C30H38N2O10 and a molecular weight of 586.64 g/mol. Its IUPAC name is ethyl 2-[3-(phenylmethoxycarbonylamino)oxetan-3-yl]propanoate;2-[3-(phenylmethoxycarbonylamino)oxetan-3-yl]propanoic acid.
| Compound Name | ethyl 2-[3-(phenylmethoxycarbonylamino)oxetan-3-yl]propanoate;2-[3-(phenylmethoxycarbonylamino)oxetan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 159072303 |
| Molecular Formula | C30H38N2O10 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | ethyl 2-[3-(phenylmethoxycarbonylamino)oxetan-3-yl]propanoate;2-[3-(phenylmethoxycarbonylamino)oxetan-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1(NC(=O)OCc2ccccc2)COC1.CCOC(=O)C(C)C1(NC(=O)OCc2ccccc2)COC1 |
| InChI | InChI=1S/C16H21NO5.C14H17NO5/c1-3-21-14(18)12(2)16(10-20-11-16)17-15(19)22-9-13-7-5-4-6-8-13;1-10(12(16)17)14(8-19-9-14)15-13(18)20-7-11-5-3-2-4-6-11/h4-8,12H,3,9-11H2,1-2H3,(H,17,19);2-6,10H,7-9H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | JZUVEPRJCQTAGC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|