C13H18F3N3O2S — CID 124595799
(3R)-N-(2-methoxyethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidine-1-carboxamide (PubChem CID 124595799) has the molecular formula C13H18F3N3O2S and a molecular weight of 337.37 g/mol. Its IUPAC name is (3R)-N-(2-methoxyethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-(2-methoxyethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 124595799 |
| Molecular Formula | C13H18F3N3O2S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (3R)-N-(2-methoxyethyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCC[C@@H](c2nc(C(F)(F)F)cs2)C1 |
| InChI | InChI=1S/C13H18F3N3O2S/c1-21-6-4-17-12(20)19-5-2-3-9(7-19)11-18-10(8-22-11)13(14,15)16/h8-9H,2-7H2,1H3,(H,17,20)/t9-/m1/s1 |
| InChIKey | MVHGEHZOBFMLEC-SECBINFHSA-N |
| XLogP | 2.70 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|