C8H7F5N2 — CID 124596401
[(1S)-1-(3,5-difluorophenyl)-2,2,2-trifluoroethyl]hydrazine (PubChem CID 124596401) has the molecular formula C8H7F5N2 and a molecular weight of 226.15 g/mol. Its IUPAC name is [(1S)-1-(3,5-difluorophenyl)-2,2,2-trifluoroethyl]hydrazine.
| Compound Name | [(1S)-1-(3,5-difluorophenyl)-2,2,2-trifluoroethyl]hydrazine |
|---|---|
| PubChem CID | 124596401 |
| Molecular Formula | C8H7F5N2 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | [(1S)-1-(3,5-difluorophenyl)-2,2,2-trifluoroethyl]hydrazine |
| SMILES | NN[C@@H](c1cc(F)cc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2/c9-5-1-4(2-6(10)3-5)7(15-14)8(11,12)13/h1-3,7,15H,14H2/t7-/m0/s1 |
| InChIKey | KEQLWXQXQKPZMO-ZETCQYMHSA-N |
| XLogP | 2.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|