C20H19N5O3 — CID 124604068
N'-(3-pyridin-2-yloxyphenyl)-N-[(5S)-4,5,6,7-tetrahydro-1H-indazol-5-yl]oxamide (PubChem CID 124604068) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is N'-(3-pyridin-2-yloxyphenyl)-N-[(5S)-4,5,6,7-tetrahydro-1H-indazol-5-yl]oxamide.
| Compound Name | N'-(3-pyridin-2-yloxyphenyl)-N-[(5S)-4,5,6,7-tetrahydro-1H-indazol-5-yl]oxamide |
|---|---|
| PubChem CID | 124604068 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N'-(3-pyridin-2-yloxyphenyl)-N-[(5S)-4,5,6,7-tetrahydro-1H-indazol-5-yl]oxamide |
| SMILES | O=C(Nc1cccc(Oc2ccccn2)c1)C(=O)N[C@H]1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C20H19N5O3/c26-19(20(27)24-15-7-8-17-13(10-15)12-22-25-17)23-14-4-3-5-16(11-14)28-18-6-1-2-9-21-18/h1-6,9,11-12,15H,7-8,10H2,(H,22,25)(H,23,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | BPFLMOZWLLNCKU-HNNXBMFYSA-N |
| XLogP | 2.21 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|