C18H20N4O3 — CID 124608069
1-[(3R)-2-oxoazepan-3-yl]-3-(3-pyridin-2-yloxyphenyl)urea (PubChem CID 124608069) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-[(3R)-2-oxoazepan-3-yl]-3-(3-pyridin-2-yloxyphenyl)urea.
| Compound Name | 1-[(3R)-2-oxoazepan-3-yl]-3-(3-pyridin-2-yloxyphenyl)urea |
|---|---|
| PubChem CID | 124608069 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[(3R)-2-oxoazepan-3-yl]-3-(3-pyridin-2-yloxyphenyl)urea |
| SMILES | O=C(Nc1cccc(Oc2ccccn2)c1)N[C@@H]1CCCCNC1=O |
| InChI | InChI=1S/C18H20N4O3/c23-17-15(8-1-3-11-20-17)22-18(24)21-13-6-5-7-14(12-13)25-16-9-2-4-10-19-16/h2,4-7,9-10,12,15H,1,3,8,11H2,(H,20,23)(H2,21,22,24)/t15-/m1/s1 |
| InChIKey | FOCQVDJEHSBGFI-OAHLLOKOSA-N |
| XLogP | 2.66 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |