C17H19N3O3S — CID 124608812
2-[(3R)-4-(5-cyclopropyl-1H-pyrazole-3-carbonyl)morpholin-3-yl]-1-thiophen-2-ylethanone (PubChem CID 124608812) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-[(3R)-4-(5-cyclopropyl-1H-pyrazole-3-carbonyl)morpholin-3-yl]-1-thiophen-2-ylethanone.
| Compound Name | 2-[(3R)-4-(5-cyclopropyl-1H-pyrazole-3-carbonyl)morpholin-3-yl]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 124608812 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[(3R)-4-(5-cyclopropyl-1H-pyrazole-3-carbonyl)morpholin-3-yl]-1-thiophen-2-ylethanone |
| SMILES | O=C(C[C@@H]1COCCN1C(=O)c1cc(C2CC2)[nH]n1)c1cccs1 |
| InChI | InChI=1S/C17H19N3O3S/c21-15(16-2-1-7-24-16)8-12-10-23-6-5-20(12)17(22)14-9-13(18-19-14)11-3-4-11/h1-2,7,9,11-12H,3-6,8,10H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | VUNLQYBAZDPVRU-GFCCVEGCSA-N |
| XLogP | 2.46 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |