C16H16F3N3O2 — CID 124611071
(7R)-N-[4-(2,2,2-trifluoroethoxy)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 124611071) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is (7R)-N-[4-(2,2,2-trifluoroethoxy)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | (7R)-N-[4-(2,2,2-trifluoroethoxy)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 124611071 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (7R)-N-[4-(2,2,2-trifluoroethoxy)phenyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)cc1)[C@@H]1CCn2ccnc2C1 |
| InChI | InChI=1S/C16H16F3N3O2/c17-16(18,19)10-24-13-3-1-12(2-4-13)21-15(23)11-5-7-22-8-6-20-14(22)9-11/h1-4,6,8,11H,5,7,9-10H2,(H,21,23)/t11-/m1/s1 |
| InChIKey | YSOKOEQQQAFSSW-LLVKDONJSA-N |
| XLogP | 3.03 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |