C16H27N3O — CID 84578906
N-(2,4,4-trimethylpentan-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 84578906) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(2,4,4-trimethylpentan-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | N-(2,4,4-trimethylpentan-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 84578906 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-(2,4,4-trimethylpentan-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C1CCn2ccnc2C1 |
| InChI | InChI=1S/C16H27N3O/c1-15(2,3)11-16(4,5)18-14(20)12-6-8-19-9-7-17-13(19)10-12/h7,9,12H,6,8,10-11H2,1-5H3,(H,18,20) |
| InChIKey | GEIAQOJGRPIIJC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |