C10H14N2 — CID 163390184
7-prop-1-en-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 163390184) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 7-prop-1-en-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine.
| Compound Name | 7-prop-1-en-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 163390184 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 7-prop-1-en-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine |
| SMILES | C=C(C)C1CCn2ccnc2C1 |
| InChI | InChI=1S/C10H14N2/c1-8(2)9-3-5-12-6-4-11-10(12)7-9/h4,6,9H,1,3,5,7H2,2H3 |
| InChIKey | SAUFQIXAOHPIIU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|