C10H12F3N3O — CID 112527700
N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 112527700) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 112527700 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCn2ccnc2C1 |
| InChI | InChI=1S/C10H12F3N3O/c11-10(12,13)6-15-9(17)7-1-3-16-4-2-14-8(16)5-7/h2,4,7H,1,3,5-6H2,(H,15,17) |
| InChIKey | XULYZVGZKPXJSR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |