C18H29N3O2 — CID 97158428
(7R)-N-[(1R,3S,4R)-2,2-diethyl-3-methoxy-4-methylcyclobutyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 97158428) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (7R)-N-[(1R,3S,4R)-2,2-diethyl-3-methoxy-4-methylcyclobutyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | (7R)-N-[(1R,3S,4R)-2,2-diethyl-3-methoxy-4-methylcyclobutyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 97158428 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (7R)-N-[(1R,3S,4R)-2,2-diethyl-3-methoxy-4-methylcyclobutyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | CCC1(CC)[C@H](NC(=O)[C@@H]2CCn3ccnc3C2)[C@@H](C)[C@@H]1OC |
| InChI | InChI=1S/C18H29N3O2/c1-5-18(6-2)15(12(3)16(18)23-4)20-17(22)13-7-9-21-10-8-19-14(21)11-13/h8,10,12-13,15-16H,5-7,9,11H2,1-4H3,(H,20,22)/t12-,13-,15-,16+/m1/s1 |
| InChIKey | DHLWLMDFOXSILW-XOUADPBQSA-N |
| XLogP | 2.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |