C11H18N2 — CID 163390526
7-butan-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine (PubChem CID 163390526) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 7-butan-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine.
| Compound Name | 7-butan-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 163390526 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 7-butan-2-yl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine |
| SMILES | CCC(C)C1CCn2ccnc2C1 |
| InChI | InChI=1S/C11H18N2/c1-3-9(2)10-4-6-13-7-5-12-11(13)8-10/h5,7,9-10H,3-4,6,8H2,1-2H3 |
| InChIKey | JICXKGUFMSTQGV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |