About (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
(7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 166913087) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Analyze (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 166913087) is (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is CC[C@@H]1CCn2ccnc21.
What is the InChIKey of (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is ZIOZRBOZELGVHN-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H12N2/c1-2-7-3-5-10-6-4-9-8(7)10/h4,6-7H,2-3,5H2,1H3/t7-/m1/s1.
What are the key properties of (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
(7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 136.20 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-ethyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 166913087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).