C20H19N3O3 — CID 124614069
(2S)-N-[3-(1,3-oxazol-2-yl)phenyl]-2-phenylmorpholine-4-carboxamide (PubChem CID 124614069) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (2S)-N-[3-(1,3-oxazol-2-yl)phenyl]-2-phenylmorpholine-4-carboxamide.
| Compound Name | (2S)-N-[3-(1,3-oxazol-2-yl)phenyl]-2-phenylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 124614069 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (2S)-N-[3-(1,3-oxazol-2-yl)phenyl]-2-phenylmorpholine-4-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ncco2)c1)N1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H19N3O3/c24-20(22-17-8-4-7-16(13-17)19-21-9-11-26-19)23-10-12-25-18(14-23)15-5-2-1-3-6-15/h1-9,11,13,18H,10,12,14H2,(H,22,24)/t18-/m1/s1 |
| InChIKey | KYWNUTOPONLUHY-GOSISDBHSA-N |
| XLogP | 3.95 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |