C19H18N4O2S — CID 97201689
(2S)-2-phenyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)morpholine-4-carboxamide (PubChem CID 97201689) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is (2S)-2-phenyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)morpholine-4-carboxamide.
| Compound Name | (2S)-2-phenyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 97201689 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2S)-2-phenyl-N-(3-phenyl-1,2,4-thiadiazol-5-yl)morpholine-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)ns1)N1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H18N4O2S/c24-19(21-18-20-17(22-26-18)15-9-5-2-6-10-15)23-11-12-25-16(13-23)14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H,20,21,22,24)/t16-/m1/s1 |
| InChIKey | GZCOJQMOCACQTL-MRXNPFEDSA-N |
| XLogP | 3.81 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |