C19H22N4O2 — CID 86803982
4-(2,5-dihydropyrrol-1-yl)-N-[3-(1,3-oxazol-2-yl)phenyl]piperidine-1-carboxamide (PubChem CID 86803982) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-(2,5-dihydropyrrol-1-yl)-N-[3-(1,3-oxazol-2-yl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(2,5-dihydropyrrol-1-yl)-N-[3-(1,3-oxazol-2-yl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86803982 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-(2,5-dihydropyrrol-1-yl)-N-[3-(1,3-oxazol-2-yl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ncco2)c1)N1CCC(N2CC=CC2)CC1 |
| InChI | InChI=1S/C19H22N4O2/c24-19(23-11-6-17(7-12-23)22-9-1-2-10-22)21-16-5-3-4-15(14-16)18-20-8-13-25-18/h1-5,8,13-14,17H,6-7,9-12H2,(H,21,24) |
| InChIKey | GGNHMZUZMOGYDU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|