C20H23N3O — CID 124614844
[(6aS)-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-(4-ethyl-2-pyridinyl)methanone (PubChem CID 124614844) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is [(6aS)-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-(4-ethyl-2-pyridinyl)methanone.
| Compound Name | [(6aS)-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-(4-ethyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 124614844 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | [(6aS)-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-(4-ethyl-2-pyridinyl)methanone |
| SMILES | CCc1ccnc(C(=O)N2C[C@@H]3CCCN3Cc3ccccc32)c1 |
| InChI | InChI=1S/C20H23N3O/c1-2-15-9-10-21-18(12-15)20(24)23-14-17-7-5-11-22(17)13-16-6-3-4-8-19(16)23/h3-4,6,8-10,12,17H,2,5,7,11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | LHZGZAOGEPUKLQ-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |