C19H23N5O — CID 138052441
6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[5-(dimethylamino)pyrazin-2-yl]methanone (PubChem CID 138052441) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[5-(dimethylamino)pyrazin-2-yl]methanone.
| Compound Name | 6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[5-(dimethylamino)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 138052441 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl-[5-(dimethylamino)pyrazin-2-yl]methanone |
| SMILES | CN(C)c1cnc(C(=O)N2CC3CCCN3Cc3ccccc32)cn1 |
| InChI | InChI=1S/C19H23N5O/c1-22(2)18-11-20-16(10-21-18)19(25)24-13-15-7-5-9-23(15)12-14-6-3-4-8-17(14)24/h3-4,6,8,10-11,15H,5,7,9,12-13H2,1-2H3 |
| InChIKey | SJGGSKLDGYWROB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |