C22H27N3O — CID 19608040
(4-aminophenyl)-(4-cyclohexyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)methanone (PubChem CID 19608040) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is (4-aminophenyl)-(4-cyclohexyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)methanone.
| Compound Name | (4-aminophenyl)-(4-cyclohexyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)methanone |
|---|---|
| PubChem CID | 19608040 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (4-aminophenyl)-(4-cyclohexyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)methanone |
| SMILES | Nc1ccc(C(=O)N2CCN(C3CCCCC3)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C22H27N3O/c23-19-12-10-17(11-13-19)22(26)25-15-14-24(20-7-2-1-3-8-20)16-18-6-4-5-9-21(18)25/h4-6,9-13,20H,1-3,7-8,14-16,23H2 |
| InChIKey | HHKVFVTVBKRRBK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|