C26H31N3O2 — CID 92710287
[(2R)-1-benzoyl-2,3-dihydroindol-2-yl]-(4-cyclohexylpiperazin-1-yl)methanone (PubChem CID 92710287) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is [(2R)-1-benzoyl-2,3-dihydroindol-2-yl]-(4-cyclohexylpiperazin-1-yl)methanone.
| Compound Name | [(2R)-1-benzoyl-2,3-dihydroindol-2-yl]-(4-cyclohexylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 92710287 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | [(2R)-1-benzoyl-2,3-dihydroindol-2-yl]-(4-cyclohexylpiperazin-1-yl)methanone |
| SMILES | O=C([C@H]1Cc2ccccc2N1C(=O)c1ccccc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H31N3O2/c30-25(20-9-3-1-4-10-20)29-23-14-8-7-11-21(23)19-24(29)26(31)28-17-15-27(16-18-28)22-12-5-2-6-13-22/h1,3-4,7-11,14,22,24H,2,5-6,12-13,15-19H2/t24-/m1/s1 |
| InChIKey | RWVTWMGNYVSTBF-XMMPIXPASA-N |
| XLogP | 3.73 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |