C20H20N2O3 — CID 20954563
(1-benzoyl-2,3-dihydroindol-2-yl)-morpholin-4-ylmethanone (PubChem CID 20954563) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (1-benzoyl-2,3-dihydroindol-2-yl)-morpholin-4-ylmethanone.
| Compound Name | (1-benzoyl-2,3-dihydroindol-2-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 20954563 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (1-benzoyl-2,3-dihydroindol-2-yl)-morpholin-4-ylmethanone |
| SMILES | O=C(C1Cc2ccccc2N1C(=O)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H20N2O3/c23-19(15-6-2-1-3-7-15)22-17-9-5-4-8-16(17)14-18(22)20(24)21-10-12-25-13-11-21/h1-9,18H,10-14H2 |
| InChIKey | MSJVGSMHOIRMSI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |