C20H30N2O2 — CID 95586430
(2R)-1-[(6aR)-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-2-(3-methylbutoxy)propan-1-one (PubChem CID 95586430) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2R)-1-[(6aR)-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-2-(3-methylbutoxy)propan-1-one.
| Compound Name | (2R)-1-[(6aR)-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-2-(3-methylbutoxy)propan-1-one |
|---|---|
| PubChem CID | 95586430 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (2R)-1-[(6aR)-6,6a,7,8,9,11-hexahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-2-(3-methylbutoxy)propan-1-one |
| SMILES | CC(C)CCO[C@H](C)C(=O)N1C[C@H]2CCCN2Cc2ccccc21 |
| InChI | InChI=1S/C20H30N2O2/c1-15(2)10-12-24-16(3)20(23)22-14-18-8-6-11-21(18)13-17-7-4-5-9-19(17)22/h4-5,7,9,15-16,18H,6,8,10-14H2,1-3H3/t16-,18-/m1/s1 |
| InChIKey | OYGHFTCYWFXONW-SJLPKXTDSA-N |
| XLogP | 3.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |