C15H19Cl2FN2O2 — CID 124615048
1-[(2S)-3-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-2-hydroxypropyl]pyrrolidin-2-one (PubChem CID 124615048) has the molecular formula C15H19Cl2FN2O2 and a molecular weight of 349.23 g/mol. Its IUPAC name is 1-[(2S)-3-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-2-hydroxypropyl]pyrrolidin-2-one.
| Compound Name | 1-[(2S)-3-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-2-hydroxypropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 124615048 |
| Molecular Formula | C15H19Cl2FN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-[(2S)-3-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-2-hydroxypropyl]pyrrolidin-2-one |
| SMILES | C[C@H](NC[C@H](O)CN1CCCC1=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2FN2O2/c1-9(11-5-14(18)13(17)6-12(11)16)19-7-10(21)8-20-4-2-3-15(20)22/h5-6,9-10,19,21H,2-4,7-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | FXUGZKGIRIGJPS-UWVGGRQHSA-N |
| XLogP | 2.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|