C19H22N2O2S — CID 124615544
2-[[(2S)-oxan-2-yl]methylsulfanyl]-N-(3-phenyl-2-pyridinyl)acetamide (PubChem CID 124615544) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[[(2S)-oxan-2-yl]methylsulfanyl]-N-(3-phenyl-2-pyridinyl)acetamide.
| Compound Name | 2-[[(2S)-oxan-2-yl]methylsulfanyl]-N-(3-phenyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 124615544 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[[(2S)-oxan-2-yl]methylsulfanyl]-N-(3-phenyl-2-pyridinyl)acetamide |
| SMILES | O=C(CSC[C@@H]1CCCCO1)Nc1ncccc1-c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2S/c22-18(14-24-13-16-9-4-5-12-23-16)21-19-17(10-6-11-20-19)15-7-2-1-3-8-15/h1-3,6-8,10-11,16H,4-5,9,12-14H2,(H,20,21,22)/t16-/m0/s1 |
| InChIKey | PPWJTRXKYIOFAY-INIZCTEOSA-N |
| XLogP | 3.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |