About 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide
2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide (PubChem CID 124885437) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide.
Molecular Properties
| Compound Name | 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide |
| PubChem CID | 124885437 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide |
| SMILES | CC[C@@H]1C[C@@H](CC(=O)Nc2ncccc2-c2ccccc2)CCO1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-17-13-15(10-12-24-17)14-19(23)22-20-18(9-6-11-21-20)16-7-4-3-5-8-16/h3-9,11,15,17H,2,10,12-14H2,1H3,(H,21,22,23)/t15-,17+/m0/s1 |
| InChIKey | MAXJUDFQHNHLQU-DOTOQJQBSA-N |
| XLogP | 4.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide?
The IUPAC name of 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide (CID 124885437) is 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide.
What is the SMILES notation for 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide?
The canonical SMILES for 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide is CC[C@@H]1C[C@@H](CC(=O)Nc2ncccc2-c2ccccc2)CCO1.
What is the InChIKey of 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide?
The InChIKey is MAXJUDFQHNHLQU-DOTOQJQBSA-N. The full InChI is InChI=1S/C20H24N2O2/c1-2-17-13-15(10-12-24-17)14-19(23)22-20-18(9-6-11-21-20)16-7-4-3-5-8-16/h3-9,11,15,17H,2,10,12-14H2,1H3,(H,21,22,23)/t15-,17+/m0/s1.
What are the key properties of 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide?
2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide has a molecular weight of 324.42 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide is sourced from PubChem (CID 124885437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).