C20H24N2O2 — CID 124885437
2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide (PubChem CID 124885437) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide.
| Compound Name | 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 124885437 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[(2R,4S)-2-ethyloxan-4-yl]-N-(3-phenyl-2-pyridinyl)acetamide |
| SMILES | CC[C@@H]1C[C@@H](CC(=O)Nc2ncccc2-c2ccccc2)CCO1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-17-13-15(10-12-24-17)14-19(23)22-20-18(9-6-11-21-20)16-7-4-3-5-8-16/h3-9,11,15,17H,2,10,12-14H2,1H3,(H,21,22,23)/t15-,17+/m0/s1 |
| InChIKey | MAXJUDFQHNHLQU-DOTOQJQBSA-N |
| XLogP | 4.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |