C14H23NO3 — CID 124616125
(2S)-1-[(2S)-2-(furan-2-yl)azepan-1-yl]-3-methoxypropan-2-ol (PubChem CID 124616125) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-(furan-2-yl)azepan-1-yl]-3-methoxypropan-2-ol.
| Compound Name | (2S)-1-[(2S)-2-(furan-2-yl)azepan-1-yl]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 124616125 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (2S)-1-[(2S)-2-(furan-2-yl)azepan-1-yl]-3-methoxypropan-2-ol |
| SMILES | COC[C@@H](O)CN1CCCCC[C@H]1c1ccco1 |
| InChI | InChI=1S/C14H23NO3/c1-17-11-12(16)10-15-8-4-2-3-6-13(15)14-7-5-9-18-14/h5,7,9,12-13,16H,2-4,6,8,10-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | VVSQPTKJMHGENI-STQMWFEESA-N |
| XLogP | 2.20 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |