C14H19N3O — CID 124618528
6-[3-[(2R)-oxan-2-yl]propylamino]pyridine-2-carbonitrile (PubChem CID 124618528) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-[3-[(2R)-oxan-2-yl]propylamino]pyridine-2-carbonitrile.
| Compound Name | 6-[3-[(2R)-oxan-2-yl]propylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 124618528 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 6-[3-[(2R)-oxan-2-yl]propylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(NCCC[C@H]2CCCCO2)n1 |
| InChI | InChI=1S/C14H19N3O/c15-11-12-5-3-8-14(17-12)16-9-4-7-13-6-1-2-10-18-13/h3,5,8,13H,1-2,4,6-7,9-10H2,(H,16,17)/t13-/m1/s1 |
| InChIKey | IQYHKAZJORDMHO-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|