C16H24FNO3 — CID 124619964
2-[[[(1R,3R)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methylamino]methyl]-4-fluorophenol (PubChem CID 124619964) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-[[[(1R,3R)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methylamino]methyl]-4-fluorophenol.
| Compound Name | 2-[[[(1R,3R)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methylamino]methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 124619964 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-[[[(1R,3R)-3-ethoxy-1-hydroxy-2,2-dimethylcyclobutyl]methylamino]methyl]-4-fluorophenol |
| SMILES | CCO[C@@H]1C[C@](O)(CNCc2cc(F)ccc2O)C1(C)C |
| InChI | InChI=1S/C16H24FNO3/c1-4-21-14-8-16(20,15(14,2)3)10-18-9-11-7-12(17)5-6-13(11)19/h5-7,14,18-20H,4,8-10H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | LMKCZIOMDZTAGA-ZBFHGGJFSA-N |
| XLogP | 2.19 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|