C14H16ClFN2O3 — CID 124621986
N-(3-chloro-5-fluorophenyl)-2-[(2R,3S)-2,3-dimethylmorpholin-4-yl]-2-oxoacetamide (PubChem CID 124621986) has the molecular formula C14H16ClFN2O3 and a molecular weight of 314.74 g/mol. Its IUPAC name is N-(3-chloro-5-fluorophenyl)-2-[(2R,3S)-2,3-dimethylmorpholin-4-yl]-2-oxoacetamide.
| Compound Name | N-(3-chloro-5-fluorophenyl)-2-[(2R,3S)-2,3-dimethylmorpholin-4-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 124621986 |
| Molecular Formula | C14H16ClFN2O3 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | N-(3-chloro-5-fluorophenyl)-2-[(2R,3S)-2,3-dimethylmorpholin-4-yl]-2-oxoacetamide |
| SMILES | C[C@H]1OCCN(C(=O)C(=O)Nc2cc(F)cc(Cl)c2)[C@H]1C |
| InChI | InChI=1S/C14H16ClFN2O3/c1-8-9(2)21-4-3-18(8)14(20)13(19)17-12-6-10(15)5-11(16)7-12/h5-9H,3-4H2,1-2H3,(H,17,19)/t8-,9+/m0/s1 |
| InChIKey | XMYRKWWSBOWYAK-DTWKUNHWSA-N |
| XLogP | 2.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|