C17H23F2N3O2 — CID 97332424
(2S,3R)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2,3-dimethylmorpholine-4-carboxamide (PubChem CID 97332424) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2S,3R)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2,3-dimethylmorpholine-4-carboxamide.
| Compound Name | (2S,3R)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2,3-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 97332424 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2S,3R)-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2,3-dimethylmorpholine-4-carboxamide |
| SMILES | C[C@@H]1OCCN(C(=O)Nc2cc(F)c(N3CCCC3)c(F)c2)[C@@H]1C |
| InChI | InChI=1S/C17H23F2N3O2/c1-11-12(2)24-8-7-22(11)17(23)20-13-9-14(18)16(15(19)10-13)21-5-3-4-6-21/h9-12H,3-8H2,1-2H3,(H,20,23)/t11-,12+/m1/s1 |
| InChIKey | JTBXVWOQDNJQHO-NEPJUHHUSA-N |
| XLogP | 3.21 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|