C14H22N2O — CID 124623554
(3S)-3-methyl-N-(2,4,6-trimethyl-3-pyridinyl)pentanamide (PubChem CID 124623554) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (3S)-3-methyl-N-(2,4,6-trimethyl-3-pyridinyl)pentanamide.
| Compound Name | (3S)-3-methyl-N-(2,4,6-trimethyl-3-pyridinyl)pentanamide |
|---|---|
| PubChem CID | 124623554 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (3S)-3-methyl-N-(2,4,6-trimethyl-3-pyridinyl)pentanamide |
| SMILES | CC[C@H](C)CC(=O)Nc1c(C)cc(C)nc1C |
| InChI | InChI=1S/C14H22N2O/c1-6-9(2)7-13(17)16-14-10(3)8-11(4)15-12(14)5/h8-9H,6-7H2,1-5H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | NNAYTGFTGKLSFW-VIFPVBQESA-N |
| XLogP | 3.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |