C18H26N2O3 — CID 124624773
N-[(1S,2S)-2-methylcyclohexyl]-N'-(4-propoxyphenyl)oxamide (PubChem CID 124624773) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohexyl]-N'-(4-propoxyphenyl)oxamide.
| Compound Name | N-[(1S,2S)-2-methylcyclohexyl]-N'-(4-propoxyphenyl)oxamide |
|---|---|
| PubChem CID | 124624773 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohexyl]-N'-(4-propoxyphenyl)oxamide |
| SMILES | CCCOc1ccc(NC(=O)C(=O)N[C@H]2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-3-12-23-15-10-8-14(9-11-15)19-17(21)18(22)20-16-7-5-4-6-13(16)2/h8-11,13,16H,3-7,12H2,1-2H3,(H,19,21)(H,20,22)/t13-,16-/m0/s1 |
| InChIKey | OZRKEYHBSIOAKK-BBRMVZONSA-N |
| XLogP | 3.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|