C17H20F3N3O — CID 124625465
1-[(1R)-cyclohex-3-en-1-yl]-3-[2-(2,2,2-trifluoroethyl)-1,3-dihydroisoindol-4-yl]urea (PubChem CID 124625465) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is 1-[(1R)-cyclohex-3-en-1-yl]-3-[2-(2,2,2-trifluoroethyl)-1,3-dihydroisoindol-4-yl]urea.
| Compound Name | 1-[(1R)-cyclohex-3-en-1-yl]-3-[2-(2,2,2-trifluoroethyl)-1,3-dihydroisoindol-4-yl]urea |
|---|---|
| PubChem CID | 124625465 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[(1R)-cyclohex-3-en-1-yl]-3-[2-(2,2,2-trifluoroethyl)-1,3-dihydroisoindol-4-yl]urea |
| SMILES | O=C(Nc1cccc2c1CN(CC(F)(F)F)C2)N[C@H]1CC=CCC1 |
| InChI | InChI=1S/C17H20F3N3O/c18-17(19,20)11-23-9-12-5-4-8-15(14(12)10-23)22-16(24)21-13-6-2-1-3-7-13/h1-2,4-5,8,13H,3,6-7,9-11H2,(H2,21,22,24)/t13-/m0/s1 |
| InChIKey | MXGAKZRDTTVBBU-ZDUSSCGKSA-N |
| XLogP | 3.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|