C16H18F3NO — CID 71921099
N-[2-(3,3,3-trifluoropropyl)phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 71921099) has the molecular formula C16H18F3NO and a molecular weight of 297.32 g/mol. Its IUPAC name is N-[2-(3,3,3-trifluoropropyl)phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[2-(3,3,3-trifluoropropyl)phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 71921099 |
| Molecular Formula | C16H18F3NO |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[2-(3,3,3-trifluoropropyl)phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1ccccc1CCC(F)(F)F)C1CC=CCC1 |
| InChI | InChI=1S/C16H18F3NO/c17-16(18,19)11-10-12-6-4-5-9-14(12)20-15(21)13-7-2-1-3-8-13/h1-2,4-6,9,13H,3,7-8,10-11H2,(H,20,21) |
| InChIKey | AGUMSXOTBAKJLG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|