C17H21F3N4O — CID 175826837
1-(1-methylpiperidin-4-yl)-3-[1-(2,2,2-trifluoroethyl)indol-4-yl]urea (PubChem CID 175826837) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-3-[1-(2,2,2-trifluoroethyl)indol-4-yl]urea.
| Compound Name | 1-(1-methylpiperidin-4-yl)-3-[1-(2,2,2-trifluoroethyl)indol-4-yl]urea |
|---|---|
| PubChem CID | 175826837 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-3-[1-(2,2,2-trifluoroethyl)indol-4-yl]urea |
| SMILES | CN1CCC(NC(=O)Nc2cccc3c2ccn3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C17H21F3N4O/c1-23-8-5-12(6-9-23)21-16(25)22-14-3-2-4-15-13(14)7-10-24(15)11-17(18,19)20/h2-4,7,10,12H,5-6,8-9,11H2,1H3,(H2,21,22,25) |
| InChIKey | IKMYISVEZXAPBU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |